C17H18FN3O4 — CID 143989695
2-(2,5-dioxoimidazolidin-4-yl)-6-fluoro-N-pentyl-1-benzofuran-5-carboxamide (PubChem CID 143989695) has the molecular formula C17H18FN3O4 and a molecular weight of 347.35 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-4-yl)-6-fluoro-N-pentyl-1-benzofuran-5-carboxamide.
| Compound Name | 2-(2,5-dioxoimidazolidin-4-yl)-6-fluoro-N-pentyl-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 143989695 |
| Molecular Formula | C17H18FN3O4 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-4-yl)-6-fluoro-N-pentyl-1-benzofuran-5-carboxamide |
| SMILES | CCCCCNC(=O)c1cc2cc(C3NC(=O)NC3=O)oc2cc1F |
| InChI | InChI=1S/C17H18FN3O4/c1-2-3-4-5-19-15(22)10-6-9-7-13(25-12(9)8-11(10)18)14-16(23)21-17(24)20-14/h6-8,14H,2-5H2,1H3,(H,19,22)(H2,20,21,23,24) |
| InChIKey | IBSICANJGCCKDQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|