C27H32N6O5 — CID 143989779
5-[5-[(Z)-3-(3,5-dimethylpiperazin-1-yl)-3-methyliminoprop-1-enyl]furan-2-yl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 143989779) has the molecular formula C27H32N6O5 and a molecular weight of 520.59 g/mol. Its IUPAC name is 5-[5-[(Z)-3-(3,5-dimethylpiperazin-1-yl)-3-methyliminoprop-1-enyl]furan-2-yl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[5-[(Z)-3-(3,5-dimethylpiperazin-1-yl)-3-methyliminoprop-1-enyl]furan-2-yl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143989779 |
| Molecular Formula | C27H32N6O5 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 5-[5-[(Z)-3-(3,5-dimethylpiperazin-1-yl)-3-methyliminoprop-1-enyl]furan-2-yl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | C/N=C(/C=C\c1ccc(C2(CN3Cc4ccc(OC)cc4C3=O)NC(=O)NC2=O)o1)N1CC(C)NC(C)C1 |
| InChI | InChI=1S/C27H32N6O5/c1-16-12-32(13-17(2)29-16)23(28-3)10-8-19-7-9-22(38-19)27(25(35)30-26(36)31-27)15-33-14-18-5-6-20(37-4)11-21(18)24(33)34/h5-11,16-17,29H,12-15H2,1-4H3,(H2,30,31,35,36)/b10-8-,28-23- |
| InChIKey | MESLQSZUSYQHCA-RWMWJEDCSA-N |
| XLogP | 1.70 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|