C25H26FN5O5 — CID 143990702
ethane;(5S)-5-[2-(4-fluoro-3-oxo-1,2-dihydroindazol-6-yl)ethynyl]imidazolidine-2,4-dione;5-methoxy-2-methyl-1,8-dihydrocyclohepta[c]pyrrol-3-one (PubChem CID 143990702) has the molecular formula C25H26FN5O5 and a molecular weight of 495.51 g/mol. Its IUPAC name is ethane;(5S)-5-[2-(4-fluoro-3-oxo-1,2-dihydroindazol-6-yl)ethynyl]imidazolidine-2,4-dione;5-methoxy-2-methyl-1,8-dihydrocyclohepta[c]pyrrol-3-one.
| Compound Name | ethane;(5S)-5-[2-(4-fluoro-3-oxo-1,2-dihydroindazol-6-yl)ethynyl]imidazolidine-2,4-dione;5-methoxy-2-methyl-1,8-dihydrocyclohepta[c]pyrrol-3-one |
|---|---|
| PubChem CID | 143990702 |
| Molecular Formula | C25H26FN5O5 |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | ethane;(5S)-5-[2-(4-fluoro-3-oxo-1,2-dihydroindazol-6-yl)ethynyl]imidazolidine-2,4-dione;5-methoxy-2-methyl-1,8-dihydrocyclohepta[c]pyrrol-3-one |
| SMILES | CC.COC1=CC2=C(CC=C1)CN(C)C2=O.O=C1NC(=O)[C@H](C#Cc2cc(F)c3c(=O)[nH][nH]c3c2)N1 |
| InChI | InChI=1S/C12H7FN4O3.C11H13NO2.C2H6/c13-6-3-5(4-8-9(6)11(19)17-16-8)1-2-7-10(18)15-12(20)14-7;1-12-7-8-4-3-5-9(14-2)6-10(8)11(12)13;1-2/h3-4,7H,(H2,16,17,19)(H2,14,15,18,20);3,5-6H,4,7H2,1-2H3;1-2H3/t7-;;/m0../s1 |
| InChIKey | VKLKTMDCIHGMNN-KLXURFKVSA-N |
| XLogP | 1.83 |
| TPSA | 136.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|