C24H26FN5O5 — CID 143991486
4-(1-fluoroethyl)-3-[(Z)-3-methoxybut-1-enyl]-1-methyl-2H-pyrrol-5-one;(5S)-5-[2-(3-oxo-1,2-dihydroindazol-6-yl)ethynyl]imidazolidine-2,4-dione (PubChem CID 143991486) has the molecular formula C24H26FN5O5 and a molecular weight of 483.50 g/mol. Its IUPAC name is 4-(1-fluoroethyl)-3-[(Z)-3-methoxybut-1-enyl]-1-methyl-2H-pyrrol-5-one;(5S)-5-[2-(3-oxo-1,2-dihydroindazol-6-yl)ethynyl]imidazolidine-2,4-dione.
| Compound Name | 4-(1-fluoroethyl)-3-[(Z)-3-methoxybut-1-enyl]-1-methyl-2H-pyrrol-5-one;(5S)-5-[2-(3-oxo-1,2-dihydroindazol-6-yl)ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143991486 |
| Molecular Formula | C24H26FN5O5 |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 4-(1-fluoroethyl)-3-[(Z)-3-methoxybut-1-enyl]-1-methyl-2H-pyrrol-5-one;(5S)-5-[2-(3-oxo-1,2-dihydroindazol-6-yl)ethynyl]imidazolidine-2,4-dione |
| SMILES | COC(C)/C=C\C1=C(C(C)F)C(=O)N(C)C1.O=C1NC(=O)[C@H](C#Cc2ccc3c(=O)[nH][nH]c3c2)N1 |
| InChI | InChI=1S/C12H18FNO2.C12H8N4O3/c1-8(16-4)5-6-10-7-14(3)12(15)11(10)9(2)13;17-10-7-3-1-6(5-9(7)15-16-10)2-4-8-11(18)14-12(19)13-8/h5-6,8-9H,7H2,1-4H3;1,3,5,8H,(H2,15,16,17)(H2,13,14,18,19)/b6-5-;/t;8-/m.0/s1 |
| InChIKey | GBMCOQMWJOIUBA-YSZVTVSISA-N |
| XLogP | 1.12 |
| TPSA | 136.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|