C13H9N5O2 — CID 143990849
5-[2-[5-(1H-pyrazol-4-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione (PubChem CID 143990849) has the molecular formula C13H9N5O2 and a molecular weight of 267.25 g/mol. Its IUPAC name is 5-[2-[5-(1H-pyrazol-4-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione.
| Compound Name | 5-[2-[5-(1H-pyrazol-4-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143990849 |
| Molecular Formula | C13H9N5O2 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 5-[2-[5-(1H-pyrazol-4-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(C#Cc2cncc(-c3cn[nH]c3)c2)N1 |
| InChI | InChI=1S/C13H9N5O2/c19-12-11(17-13(20)18-12)2-1-8-3-9(5-14-4-8)10-6-15-16-7-10/h3-7,11H,(H,15,16)(H2,17,18,19,20) |
| InChIKey | PQQHVIXKAMRTJF-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|