C12H18FNO2 — CID 143991487
4-(1-fluoroethyl)-3-[(Z)-3-methoxybut-1-enyl]-1-methyl-2H-pyrrol-5-one (PubChem CID 143991487) has the molecular formula C12H18FNO2 and a molecular weight of 227.28 g/mol. Its IUPAC name is 4-(1-fluoroethyl)-3-[(Z)-3-methoxybut-1-enyl]-1-methyl-2H-pyrrol-5-one.
| Compound Name | 4-(1-fluoroethyl)-3-[(Z)-3-methoxybut-1-enyl]-1-methyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 143991487 |
| Molecular Formula | C12H18FNO2 |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 4-(1-fluoroethyl)-3-[(Z)-3-methoxybut-1-enyl]-1-methyl-2H-pyrrol-5-one |
| SMILES | COC(C)/C=C\C1=C(C(C)F)C(=O)N(C)C1 |
| InChI | InChI=1S/C12H18FNO2/c1-8(16-4)5-6-10-7-14(3)12(15)11(10)9(2)13/h5-6,8-9H,7H2,1-4H3/b6-5- |
| InChIKey | VPXDYFBQCCWEQG-WAYWQWQTSA-N |
| XLogP | 1.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |