C18H31NO3 — CID 143887393
(Z)-N-acetyl-N-but-3-enyl-5-methoxy-2-propan-2-ylidenehex-3-enamide;ethane (PubChem CID 143887393) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is (Z)-N-acetyl-N-but-3-enyl-5-methoxy-2-propan-2-ylidenehex-3-enamide;ethane.
| Compound Name | (Z)-N-acetyl-N-but-3-enyl-5-methoxy-2-propan-2-ylidenehex-3-enamide;ethane |
|---|---|
| PubChem CID | 143887393 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | (Z)-N-acetyl-N-but-3-enyl-5-methoxy-2-propan-2-ylidenehex-3-enamide;ethane |
| SMILES | C=CCCN(C(C)=O)C(=O)C(/C=C\C(C)OC)=C(C)C.CC |
| InChI | InChI=1S/C16H25NO3.C2H6/c1-7-8-11-17(14(5)18)16(19)15(12(2)3)10-9-13(4)20-6;1-2/h7,9-10,13H,1,8,11H2,2-6H3;1-2H3/b10-9-; |
| InChIKey | ALXPZOGMCKNLME-KVVVOXFISA-N |
| XLogP | 3.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|