C19H29NO2 — CID 123850279
N-ethyl-N-(2-ethylidene-4-methoxy-5-methylhexa-3,5-dienyl)-4-methylidenehex-2-enamide (PubChem CID 123850279) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is N-ethyl-N-(2-ethylidene-4-methoxy-5-methylhexa-3,5-dienyl)-4-methylidenehex-2-enamide.
| Compound Name | N-ethyl-N-(2-ethylidene-4-methoxy-5-methylhexa-3,5-dienyl)-4-methylidenehex-2-enamide |
|---|---|
| PubChem CID | 123850279 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | N-ethyl-N-(2-ethylidene-4-methoxy-5-methylhexa-3,5-dienyl)-4-methylidenehex-2-enamide |
| SMILES | C=C(C=CC(=O)N(CC)CC(=CC)C=C(OC)C(=C)C)CC |
| InChI | InChI=1S/C19H29NO2/c1-8-16(6)11-12-19(21)20(10-3)14-17(9-2)13-18(22-7)15(4)5/h9,11-13H,4,6,8,10,14H2,1-3,5,7H3 |
| InChIKey | CGMJCTJBTMIKAR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|