C19H15ClO3S — CID 143992994
2-[6-chloro-4-(4-methylsulfanylphenoxy)naphthalen-2-yl]acetic acid (PubChem CID 143992994) has the molecular formula C19H15ClO3S and a molecular weight of 358.85 g/mol. Its IUPAC name is 2-[6-chloro-4-(4-methylsulfanylphenoxy)naphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-chloro-4-(4-methylsulfanylphenoxy)naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 143992994 |
| Molecular Formula | C19H15ClO3S |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-[6-chloro-4-(4-methylsulfanylphenoxy)naphthalen-2-yl]acetic acid |
| SMILES | CSc1ccc(Oc2cc(CC(=O)O)cc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C19H15ClO3S/c1-24-16-6-4-15(5-7-16)23-18-9-12(10-19(21)22)8-13-2-3-14(20)11-17(13)18/h2-9,11H,10H2,1H3,(H,21,22) |
| InChIKey | OBCGULOMQHHQBY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |