C21H19ClO3S — CID 143993026
2-[6-chloro-3-methyl-4-(3-methyl-4-methylsulfanylphenoxy)naphthalen-2-yl]acetic acid (PubChem CID 143993026) has the molecular formula C21H19ClO3S and a molecular weight of 386.90 g/mol. Its IUPAC name is 2-[6-chloro-3-methyl-4-(3-methyl-4-methylsulfanylphenoxy)naphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-chloro-3-methyl-4-(3-methyl-4-methylsulfanylphenoxy)naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 143993026 |
| Molecular Formula | C21H19ClO3S |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 2-[6-chloro-3-methyl-4-(3-methyl-4-methylsulfanylphenoxy)naphthalen-2-yl]acetic acid |
| SMILES | CSc1ccc(Oc2c(C)c(CC(=O)O)cc3ccc(Cl)cc23)cc1C |
| InChI | InChI=1S/C21H19ClO3S/c1-12-8-17(6-7-19(12)26-3)25-21-13(2)15(10-20(23)24)9-14-4-5-16(22)11-18(14)21/h4-9,11H,10H2,1-3H3,(H,23,24) |
| InChIKey | HQQLVSHSCINEGY-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |