C21H19FO5S — CID 46203582
2-[4-(4-ethylsulfonylphenoxy)-6-fluoro-3-methylnaphthalen-2-yl]acetic acid (PubChem CID 46203582) has the molecular formula C21H19FO5S and a molecular weight of 402.44 g/mol. Its IUPAC name is 2-[4-(4-ethylsulfonylphenoxy)-6-fluoro-3-methylnaphthalen-2-yl]acetic acid.
| Compound Name | 2-[4-(4-ethylsulfonylphenoxy)-6-fluoro-3-methylnaphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 46203582 |
| Molecular Formula | C21H19FO5S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 2-[4-(4-ethylsulfonylphenoxy)-6-fluoro-3-methylnaphthalen-2-yl]acetic acid |
| SMILES | CCS(=O)(=O)c1ccc(Oc2c(C)c(CC(=O)O)cc3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C21H19FO5S/c1-3-28(25,26)18-8-6-17(7-9-18)27-21-13(2)15(11-20(23)24)10-14-4-5-16(22)12-19(14)21/h4-10,12H,3,11H2,1-2H3,(H,23,24) |
| InChIKey | COOADHKQTOFDBG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |