C21H16F4O3 — CID 46205855
2-[6-fluoro-3-methyl-4-[[4-(trifluoromethoxy)phenyl]methyl]naphthalen-2-yl]acetic acid (PubChem CID 46205855) has the molecular formula C21H16F4O3 and a molecular weight of 392.35 g/mol. Its IUPAC name is 2-[6-fluoro-3-methyl-4-[[4-(trifluoromethoxy)phenyl]methyl]naphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-fluoro-3-methyl-4-[[4-(trifluoromethoxy)phenyl]methyl]naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 46205855 |
| Molecular Formula | C21H16F4O3 |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 2-[6-fluoro-3-methyl-4-[[4-(trifluoromethoxy)phenyl]methyl]naphthalen-2-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)cc2ccc(F)cc2c1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H16F4O3/c1-12-15(10-20(26)27)9-14-4-5-16(22)11-19(14)18(12)8-13-2-6-17(7-3-13)28-21(23,24)25/h2-7,9,11H,8,10H2,1H3,(H,26,27) |
| InChIKey | XUBUXUGTAVDABU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |