C18H12ClF4NO3 — CID 171484548
6-chloro-7-fluoro-1-hydroxy-2-methyl-3-[[4-(trifluoromethoxy)phenyl]methyl]quinolin-4-one (PubChem CID 171484548) has the molecular formula C18H12ClF4NO3 and a molecular weight of 401.74 g/mol. Its IUPAC name is 6-chloro-7-fluoro-1-hydroxy-2-methyl-3-[[4-(trifluoromethoxy)phenyl]methyl]quinolin-4-one.
| Compound Name | 6-chloro-7-fluoro-1-hydroxy-2-methyl-3-[[4-(trifluoromethoxy)phenyl]methyl]quinolin-4-one |
|---|---|
| PubChem CID | 171484548 |
| Molecular Formula | C18H12ClF4NO3 |
| Molecular Weight | 401.74 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 6-chloro-7-fluoro-1-hydroxy-2-methyl-3-[[4-(trifluoromethoxy)phenyl]methyl]quinolin-4-one |
| SMILES | Cc1c(Cc2ccc(OC(F)(F)F)cc2)c(=O)c2cc(Cl)c(F)cc2n1O |
| InChI | InChI=1S/C18H12ClF4NO3/c1-9-12(6-10-2-4-11(5-3-10)27-18(21,22)23)17(25)13-7-14(19)15(20)8-16(13)24(9)26/h2-5,7-8,26H,6H2,1H3 |
| InChIKey | JSJNPPRDRVUKJK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.74 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|