C12H8ClF3N2O3 — CID 66424380
5-chloro-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-dione (PubChem CID 66424380) has the molecular formula C12H8ClF3N2O3 and a molecular weight of 320.65 g/mol. Its IUPAC name is 5-chloro-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-dione.
| Compound Name | 5-chloro-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66424380 |
| Molecular Formula | C12H8ClF3N2O3 |
| Molecular Weight | 320.65 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 5-chloro-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccc(OC(F)(F)F)cc2)cc1Cl |
| InChI | InChI=1S/C12H8ClF3N2O3/c13-9-6-18(11(20)17-10(9)19)5-7-1-3-8(4-2-7)21-12(14,15)16/h1-4,6H,5H2,(H,17,19,20) |
| InChIKey | IRLUJXJPHMEHRY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.65 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |