C24H17ClF3NO4 — CID 170432119
6-chloro-1-hydroxy-7-methoxy-2-methyl-3-[4-[4-(trifluoromethoxy)phenyl]phenyl]quinolin-4-one (PubChem CID 170432119) has the molecular formula C24H17ClF3NO4 and a molecular weight of 475.85 g/mol. Its IUPAC name is 6-chloro-1-hydroxy-7-methoxy-2-methyl-3-[4-[4-(trifluoromethoxy)phenyl]phenyl]quinolin-4-one.
| Compound Name | 6-chloro-1-hydroxy-7-methoxy-2-methyl-3-[4-[4-(trifluoromethoxy)phenyl]phenyl]quinolin-4-one |
|---|---|
| PubChem CID | 170432119 |
| Molecular Formula | C24H17ClF3NO4 |
| Molecular Weight | 475.85 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | 6-chloro-1-hydroxy-7-methoxy-2-methyl-3-[4-[4-(trifluoromethoxy)phenyl]phenyl]quinolin-4-one |
| SMILES | COc1cc2c(cc1Cl)c(=O)c(-c1ccc(-c3ccc(OC(F)(F)F)cc3)cc1)c(C)n2O |
| InChI | InChI=1S/C24H17ClF3NO4/c1-13-22(23(30)18-11-19(25)21(32-2)12-20(18)29(13)31)16-5-3-14(4-6-16)15-7-9-17(10-8-15)33-24(26,27)28/h3-12,31H,1-2H3 |
| InChIKey | KQUHOVBCWLEEHE-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.85 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|