C7H16BNO2 — CID 14399380
2-propan-2-yl-1,3,6,2-dioxazaborocane (PubChem CID 14399380) has the molecular formula C7H16BNO2 and a molecular weight of 157.02 g/mol. Its IUPAC name is 2-propan-2-yl-1,3,6,2-dioxazaborocane.
| Compound Name | 2-propan-2-yl-1,3,6,2-dioxazaborocane |
|---|---|
| PubChem CID | 14399380 |
| Molecular Formula | C7H16BNO2 |
| Molecular Weight | 157.02 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | 2-propan-2-yl-1,3,6,2-dioxazaborocane |
| SMILES | CC(C)B1OCCNCCO1 |
| InChI | InChI=1S/C7H16BNO2/c1-7(2)8-10-5-3-9-4-6-11-8/h7,9H,3-6H2,1-2H3 |
| InChIKey | ZUDZAAOFXMKZHD-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.02 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|