C26H31F2N5O2 — CID 143994152
3,6-difluoro-2-[1-(3-methyl-7,8-dihydro-6H-pyrazino[2,3-b]pyrazin-5-yl)ethyl]phenol;4-(4-methylphenyl)morpholine (PubChem CID 143994152) has the molecular formula C26H31F2N5O2 and a molecular weight of 483.56 g/mol. Its IUPAC name is 3,6-difluoro-2-[1-(3-methyl-7,8-dihydro-6H-pyrazino[2,3-b]pyrazin-5-yl)ethyl]phenol;4-(4-methylphenyl)morpholine.
| Compound Name | 3,6-difluoro-2-[1-(3-methyl-7,8-dihydro-6H-pyrazino[2,3-b]pyrazin-5-yl)ethyl]phenol;4-(4-methylphenyl)morpholine |
|---|---|
| PubChem CID | 143994152 |
| Molecular Formula | C26H31F2N5O2 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 3,6-difluoro-2-[1-(3-methyl-7,8-dihydro-6H-pyrazino[2,3-b]pyrazin-5-yl)ethyl]phenol;4-(4-methylphenyl)morpholine |
| SMILES | Cc1ccc(N2CCOCC2)cc1.Cc1cnc2c(n1)N(C(C)c1c(F)ccc(F)c1O)CCN2 |
| InChI | InChI=1S/C15H16F2N4O.C11H15NO/c1-8-7-19-14-15(20-8)21(6-5-18-14)9(2)12-10(16)3-4-11(17)13(12)22;1-10-2-4-11(5-3-10)12-6-8-13-9-7-12/h3-4,7,9,22H,5-6H2,1-2H3,(H,18,19);2-5H,6-9H2,1H3 |
| InChIKey | XCQKRPKTNYMMDI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|