C14H21BrN2O3 — CID 143994926
2-(1-bromoethenoxy)-N-[(1S)-1-cyclohexyl-2-(methylamino)-2-oxoethyl]prop-2-enamide (PubChem CID 143994926) has the molecular formula C14H21BrN2O3 and a molecular weight of 345.24 g/mol. Its IUPAC name is 2-(1-bromoethenoxy)-N-[(1S)-1-cyclohexyl-2-(methylamino)-2-oxoethyl]prop-2-enamide.
| Compound Name | 2-(1-bromoethenoxy)-N-[(1S)-1-cyclohexyl-2-(methylamino)-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 143994926 |
| Molecular Formula | C14H21BrN2O3 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-(1-bromoethenoxy)-N-[(1S)-1-cyclohexyl-2-(methylamino)-2-oxoethyl]prop-2-enamide |
| SMILES | C=C(Br)OC(=C)C(=O)N[C@H](C(=O)NC)C1CCCCC1 |
| InChI | InChI=1S/C14H21BrN2O3/c1-9(20-10(2)15)13(18)17-12(14(19)16-3)11-7-5-4-6-8-11/h11-12H,1-2,4-8H2,3H3,(H,16,19)(H,17,18)/t12-/m0/s1 |
| InChIKey | LHAHFHPAWMKTQY-LBPRGKRZSA-N |
| XLogP | 2.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|