C20H32F3N3O3 — CID 87412856
(2S)-N-[(1S)-1-cyclohexyl-2-(methylamino)-2-oxoethyl]-2-[(2,2,2-trifluoroacetyl)amino]non-8-enamide (PubChem CID 87412856) has the molecular formula C20H32F3N3O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is (2S)-N-[(1S)-1-cyclohexyl-2-(methylamino)-2-oxoethyl]-2-[(2,2,2-trifluoroacetyl)amino]non-8-enamide.
| Compound Name | (2S)-N-[(1S)-1-cyclohexyl-2-(methylamino)-2-oxoethyl]-2-[(2,2,2-trifluoroacetyl)amino]non-8-enamide |
|---|---|
| PubChem CID | 87412856 |
| Molecular Formula | C20H32F3N3O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | (2S)-N-[(1S)-1-cyclohexyl-2-(methylamino)-2-oxoethyl]-2-[(2,2,2-trifluoroacetyl)amino]non-8-enamide |
| SMILES | C=CCCCCC[C@H](NC(=O)C(F)(F)F)C(=O)N[C@H](C(=O)NC)C1CCCCC1 |
| InChI | InChI=1S/C20H32F3N3O3/c1-3-4-5-6-10-13-15(25-19(29)20(21,22)23)17(27)26-16(18(28)24-2)14-11-8-7-9-12-14/h3,14-16H,1,4-13H2,2H3,(H,24,28)(H,25,29)(H,26,27)/t15-,16-/m0/s1 |
| InChIKey | KTXXODXRSHSYDR-HOTGVXAUSA-N |
| XLogP | 2.98 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|