C20H23N5 — CID 143995021
(3E)-N-[[2-(4-methylcyclohepta-1,3,6-trien-1-yl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]methyl]hexa-1,3,5-trien-3-amine (PubChem CID 143995021) has the molecular formula C20H23N5 and a molecular weight of 333.44 g/mol. Its IUPAC name is (3E)-N-[[2-(4-methylcyclohepta-1,3,6-trien-1-yl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]methyl]hexa-1,3,5-trien-3-amine.
| Compound Name | (3E)-N-[[2-(4-methylcyclohepta-1,3,6-trien-1-yl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]methyl]hexa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 143995021 |
| Molecular Formula | C20H23N5 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | (3E)-N-[[2-(4-methylcyclohepta-1,3,6-trien-1-yl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]methyl]hexa-1,3,5-trien-3-amine |
| SMILES | C=C/C=C(\C=C)NCC1=CCn2nc(C3=CC=C(C)CC=C3)nc2N1 |
| InChI | InChI=1S/C20H23N5/c1-4-7-17(5-2)21-14-18-12-13-25-20(22-18)23-19(24-25)16-9-6-8-15(3)10-11-16/h4-7,9-12,21H,1-2,8,13-14H2,3H3,(H,22,23,24)/b17-7+ |
| InChIKey | OSONSJQDRLPCRH-REZTVBANSA-N |
| XLogP | 3.72 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|