C19H31N5O — CID 143995154
(Z)-2-N-(5-cyclohepta-1,4,6-trien-1-yl-2-methyl-1,2,4-triazol-3-yl)-1-N-ethylbut-2-ene-1,2-diamine;ethane;formaldehyde (PubChem CID 143995154) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is (Z)-2-N-(5-cyclohepta-1,4,6-trien-1-yl-2-methyl-1,2,4-triazol-3-yl)-1-N-ethylbut-2-ene-1,2-diamine;ethane;formaldehyde.
| Compound Name | (Z)-2-N-(5-cyclohepta-1,4,6-trien-1-yl-2-methyl-1,2,4-triazol-3-yl)-1-N-ethylbut-2-ene-1,2-diamine;ethane;formaldehyde |
|---|---|
| PubChem CID | 143995154 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | (Z)-2-N-(5-cyclohepta-1,4,6-trien-1-yl-2-methyl-1,2,4-triazol-3-yl)-1-N-ethylbut-2-ene-1,2-diamine;ethane;formaldehyde |
| SMILES | C/C=C(/CNCC)Nc1nc(C2=CCC=CC=C2)nn1C.C=O.CC |
| InChI | InChI=1S/C16H23N5.C2H6.CH2O/c1-4-14(12-17-5-2)18-16-19-15(20-21(16)3)13-10-8-6-7-9-11-13;2*1-2/h4,6-8,10-11,17H,5,9,12H2,1-3H3,(H,18,19,20);1-2H3;1H2/b14-4-;; |
| InChIKey | JMYHFKRYXIEVDF-ZOAPRJHUSA-N |
| XLogP | 3.48 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |