C23H33N5O — CID 143995696
(Z)-3-[[2-ethyl-5-[(3E,5Z)-5-methylhepta-1,3,5-trien-4-yl]-1,2,4-triazol-3-yl]amino]-4-[[(2E,4Z)-hepta-2,4-dien-3-yl]amino]but-2-enal (PubChem CID 143995696) has the molecular formula C23H33N5O and a molecular weight of 395.55 g/mol. Its IUPAC name is (Z)-3-[[2-ethyl-5-[(3E,5Z)-5-methylhepta-1,3,5-trien-4-yl]-1,2,4-triazol-3-yl]amino]-4-[[(2E,4Z)-hepta-2,4-dien-3-yl]amino]but-2-enal.
| Compound Name | (Z)-3-[[2-ethyl-5-[(3E,5Z)-5-methylhepta-1,3,5-trien-4-yl]-1,2,4-triazol-3-yl]amino]-4-[[(2E,4Z)-hepta-2,4-dien-3-yl]amino]but-2-enal |
|---|---|
| PubChem CID | 143995696 |
| Molecular Formula | C23H33N5O |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | (Z)-3-[[2-ethyl-5-[(3E,5Z)-5-methylhepta-1,3,5-trien-4-yl]-1,2,4-triazol-3-yl]amino]-4-[[(2E,4Z)-hepta-2,4-dien-3-yl]amino]but-2-enal |
| SMILES | C=C/C=C(C(\C)=C/C)/c1nc(N/C(=C\C=O)CNC(/C=C\CC)=C/C)n(CC)n1 |
| InChI | InChI=1S/C23H33N5O/c1-7-12-14-19(10-4)24-17-20(15-16-29)25-23-26-22(27-28(23)11-5)21(13-8-2)18(6)9-3/h8-10,12-16,24H,2,7,11,17H2,1,3-6H3,(H,25,26,27)/b14-12-,18-9-,19-10+,20-15-,21-13+ |
| InChIKey | YBOHEVVHMJZVCS-BJCBZKRZSA-N |
| XLogP | 4.79 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|