C27H38ClN5O2 — CID 143995060
(Z)-4-[[(3E,6E)-7-chloro-3-methoxyocta-1,3,6-trien-2-yl]amino]-3-[[2-methyl-5-[(1E,6Z)-7-methylcycloocta-1,3,6-trien-1-yl]-1,2,4-triazol-3-yl]amino]but-2-enal;ethane (PubChem CID 143995060) has the molecular formula C27H38ClN5O2 and a molecular weight of 500.09 g/mol. Its IUPAC name is (Z)-4-[[(3E,6E)-7-chloro-3-methoxyocta-1,3,6-trien-2-yl]amino]-3-[[2-methyl-5-[(1E,6Z)-7-methylcycloocta-1,3,6-trien-1-yl]-1,2,4-triazol-3-yl]amino]but-2-enal;ethane.
| Compound Name | (Z)-4-[[(3E,6E)-7-chloro-3-methoxyocta-1,3,6-trien-2-yl]amino]-3-[[2-methyl-5-[(1E,6Z)-7-methylcycloocta-1,3,6-trien-1-yl]-1,2,4-triazol-3-yl]amino]but-2-enal;ethane |
|---|---|
| PubChem CID | 143995060 |
| Molecular Formula | C27H38ClN5O2 |
| Molecular Weight | 500.09 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | (Z)-4-[[(3E,6E)-7-chloro-3-methoxyocta-1,3,6-trien-2-yl]amino]-3-[[2-methyl-5-[(1E,6Z)-7-methylcycloocta-1,3,6-trien-1-yl]-1,2,4-triazol-3-yl]amino]but-2-enal;ethane |
| SMILES | C=C(NC/C(=C/C=O)Nc1nc(/C2=C/C=CC/C=C(/C)C2)nn1C)/C(=C\C/C=C(\C)Cl)OC.CC |
| InChI | InChI=1S/C25H32ClN5O2.C2H6/c1-18-10-7-6-8-12-21(16-18)24-29-25(31(4)30-24)28-22(14-15-32)17-27-20(3)23(33-5)13-9-11-19(2)26;1-2/h6,8,10-15,27H,3,7,9,16-17H2,1-2,4-5H3,(H,28,29,30);1-2H3/b8-6?,18-10-,19-11+,21-12+,22-14-,23-13+; |
| InChIKey | VJUGLARWXJUNJZ-IADXYUSUSA-N |
| XLogP | 6.18 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.09 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|