C22H21ClIN5O3 — CID 143995039
[4-[5-[(2-butoxy-5-chloroanilino)methyl]-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl] hypoiodite (PubChem CID 143995039) has the molecular formula C22H21ClIN5O3 and a molecular weight of 565.80 g/mol. Its IUPAC name is [4-[5-[(2-butoxy-5-chloroanilino)methyl]-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl] hypoiodite.
| Compound Name | [4-[5-[(2-butoxy-5-chloroanilino)methyl]-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl] hypoiodite |
|---|---|
| PubChem CID | 143995039 |
| Molecular Formula | C22H21ClIN5O3 |
| Molecular Weight | 565.80 g/mol |
| Exact Mass | 565.04 |
| IUPAC Name | [4-[5-[(2-butoxy-5-chloroanilino)methyl]-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl] hypoiodite |
| SMILES | CCCCOc1ccc(Cl)cc1NCc1cc(=O)n2[nH]c(-c3ccc(OI)cc3)nc2n1 |
| InChI | InChI=1S/C22H21ClIN5O3/c1-2-3-10-31-19-9-6-15(23)11-18(19)25-13-16-12-20(30)29-22(26-16)27-21(28-29)14-4-7-17(32-24)8-5-14/h4-9,11-12,25H,2-3,10,13H2,1H3,(H,26,27,28) |
| InChIKey | LTNZOKHBAAVTRZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.80 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|