C20H19N5O2 — CID 53044382
5-[(4-methoxyanilino)methyl]-2-(3-methylphenyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 53044382) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 5-[(4-methoxyanilino)methyl]-2-(3-methylphenyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-[(4-methoxyanilino)methyl]-2-(3-methylphenyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 53044382 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 5-[(4-methoxyanilino)methyl]-2-(3-methylphenyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | COc1ccc(NCc2cc(=O)n3[nH]c(-c4cccc(C)c4)nc3n2)cc1 |
| InChI | InChI=1S/C20H19N5O2/c1-13-4-3-5-14(10-13)19-23-20-22-16(11-18(26)25(20)24-19)12-21-15-6-8-17(27-2)9-7-15/h3-11,21H,12H2,1-2H3,(H,22,23,24) |
| InChIKey | BAXHSCQOTVFXJU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|