C24H25N5O — CID 91091820
5-[(4-but-3-en-2-ylanilino)methyl]-2-(3-ethylphenyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 91091820) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is 5-[(4-but-3-en-2-ylanilino)methyl]-2-(3-ethylphenyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-[(4-but-3-en-2-ylanilino)methyl]-2-(3-ethylphenyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 91091820 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 5-[(4-but-3-en-2-ylanilino)methyl]-2-(3-ethylphenyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | C=CC(C)c1ccc(NCc2cc(=O)n3[nH]c(-c4cccc(CC)c4)nc3n2)cc1 |
| InChI | InChI=1S/C24H25N5O/c1-4-16(3)18-9-11-20(12-10-18)25-15-21-14-22(30)29-24(26-21)27-23(28-29)19-8-6-7-17(5-2)13-19/h4,6-14,16,25H,1,5,15H2,2-3H3,(H,26,27,28) |
| InChIKey | GMKDKTFAGAUBDT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|