C28H40N2O — CID 143995044
ethane;(Z)-5-(4-ethylanilino)-4-(prop-1-en-2-ylamino)pent-3-en-2-one;1-methyl-4-prop-1-en-2-ylbenzene (PubChem CID 143995044) has the molecular formula C28H40N2O and a molecular weight of 420.64 g/mol. Its IUPAC name is ethane;(Z)-5-(4-ethylanilino)-4-(prop-1-en-2-ylamino)pent-3-en-2-one;1-methyl-4-prop-1-en-2-ylbenzene.
| Compound Name | ethane;(Z)-5-(4-ethylanilino)-4-(prop-1-en-2-ylamino)pent-3-en-2-one;1-methyl-4-prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 143995044 |
| Molecular Formula | C28H40N2O |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | ethane;(Z)-5-(4-ethylanilino)-4-(prop-1-en-2-ylamino)pent-3-en-2-one;1-methyl-4-prop-1-en-2-ylbenzene |
| SMILES | C=C(C)N/C(=C\C(C)=O)CNc1ccc(CC)cc1.C=C(C)c1ccc(C)cc1.CC |
| InChI | InChI=1S/C16H22N2O.C10H12.C2H6/c1-5-14-6-8-15(9-7-14)17-11-16(10-13(4)19)18-12(2)3;1-8(2)10-6-4-9(3)5-7-10;1-2/h6-10,17-18H,2,5,11H2,1,3-4H3;4-7H,1H2,2-3H3;1-2H3/b16-10-;; |
| InChIKey | MXRKEIHJVPWYHR-FLPKAINGSA-N |
| XLogP | 7.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|