C11H19PS — CID 143997008
ethane;(2-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)phosphane (PubChem CID 143997008) has the molecular formula C11H19PS and a molecular weight of 214.31 g/mol. Its IUPAC name is ethane;(2-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)phosphane.
| Compound Name | ethane;(2-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)phosphane |
|---|---|
| PubChem CID | 143997008 |
| Molecular Formula | C11H19PS |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | ethane;(2-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)phosphane |
| SMILES | CC.Cc1sc2c(c1P)CCCC2 |
| InChI | InChI=1S/C9H13PS.C2H6/c1-6-9(10)7-4-2-3-5-8(7)11-6;1-2/h2-5,10H2,1H3;1-2H3 |
| InChIKey | QJWCTHOBZHBJMT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|