About 1,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]thiophene
1,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]thiophene (PubChem CID 129040041) has the molecular formula C9H12S
and a molecular weight of 152.26 g/mol. Its IUPAC name is 1,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]thiophene.
Analyze 1,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]thiophene?
The IUPAC name of 1,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]thiophene (CID 129040041) is 1,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]thiophene.
What is the SMILES notation for 1,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]thiophene?
The canonical SMILES for 1,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]thiophene is Cc1sc(C)c2c1CCC2.
What is the InChIKey of 1,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]thiophene?
The InChIKey is WPOOKHILFLDTGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12S/c1-6-8-4-3-5-9(8)7(2)10-6/h3-5H2,1-2H3.
What are the key properties of 1,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]thiophene?
1,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]thiophene has a molecular weight of 152.26 g/mol, XLogP of 2.85, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]thiophene is sourced from PubChem (CID 129040041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).