C12H20S — CID 15260863
2,3,4,5-tetraethylthiophene (PubChem CID 15260863) has the molecular formula C12H20S and a molecular weight of 196.36 g/mol. Its IUPAC name is 2,3,4,5-tetraethylthiophene.
| Compound Name | 2,3,4,5-tetraethylthiophene |
|---|---|
| PubChem CID | 15260863 |
| Molecular Formula | C12H20S |
| Molecular Weight | 196.36 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2,3,4,5-tetraethylthiophene |
| SMILES | CCc1sc(CC)c(CC)c1CC |
| InChI | InChI=1S/C12H20S/c1-5-9-10(6-2)12(8-4)13-11(9)7-3/h5-8H2,1-4H3 |
| InChIKey | JWGWXSHNLZYQHR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |