C14H20S — CID 11138657
3,4-dibutyl-2-ethynylthiophene (PubChem CID 11138657) has the molecular formula C14H20S and a molecular weight of 220.38 g/mol. Its IUPAC name is 3,4-dibutyl-2-ethynylthiophene.
| Compound Name | 3,4-dibutyl-2-ethynylthiophene |
|---|---|
| PubChem CID | 11138657 |
| Molecular Formula | C14H20S |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 3,4-dibutyl-2-ethynylthiophene |
| SMILES | C#Cc1scc(CCCC)c1CCCC |
| InChI | InChI=1S/C14H20S/c1-4-7-9-12-11-15-14(6-3)13(12)10-8-5-2/h3,11H,4-5,7-10H2,1-2H3 |
| InChIKey | UTGWFDLRIGOITG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|