C11H14OS — CID 169484881
3-(3-butylthiophen-2-yl)prop-2-yn-1-ol (PubChem CID 169484881) has the molecular formula C11H14OS and a molecular weight of 194.30 g/mol. Its IUPAC name is 3-(3-butylthiophen-2-yl)prop-2-yn-1-ol.
| Compound Name | 3-(3-butylthiophen-2-yl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 169484881 |
| Molecular Formula | C11H14OS |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 3-(3-butylthiophen-2-yl)prop-2-yn-1-ol |
| SMILES | CCCCc1ccsc1C#CCO |
| InChI | InChI=1S/C11H14OS/c1-2-3-5-10-7-9-13-11(10)6-4-8-12/h7,9,12H,2-3,5,8H2,1H3 |
| InChIKey | BFLYJFJKJVCAGB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|