C23H24N2OS2 — CID 12972034
4-[7-[2-(3-hexylthiophen-2-yl)ethynyl]-2,1,3-benzothiadiazol-4-yl]-2-methylbut-3-yn-2-ol (PubChem CID 12972034) has the molecular formula C23H24N2OS2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 4-[7-[2-(3-hexylthiophen-2-yl)ethynyl]-2,1,3-benzothiadiazol-4-yl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[7-[2-(3-hexylthiophen-2-yl)ethynyl]-2,1,3-benzothiadiazol-4-yl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 12972034 |
| Molecular Formula | C23H24N2OS2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 4-[7-[2-(3-hexylthiophen-2-yl)ethynyl]-2,1,3-benzothiadiazol-4-yl]-2-methylbut-3-yn-2-ol |
| SMILES | CCCCCCc1ccsc1C#Cc1ccc(C#CC(C)(C)O)c2nsnc12 |
| InChI | InChI=1S/C23H24N2OS2/c1-4-5-6-7-8-17-14-16-27-20(17)12-11-18-9-10-19(13-15-23(2,3)26)22-21(18)24-28-25-22/h9-10,14,16,26H,4-8H2,1-3H3 |
| InChIKey | MEIVCDVIEQUXFW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|