C20H36S — CID 23325202
2,3,4,5-tetrabutylthiophene (PubChem CID 23325202) has the molecular formula C20H36S and a molecular weight of 308.57 g/mol. Its IUPAC name is 2,3,4,5-tetrabutylthiophene.
| Compound Name | 2,3,4,5-tetrabutylthiophene |
|---|---|
| PubChem CID | 23325202 |
| Molecular Formula | C20H36S |
| Molecular Weight | 308.57 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 2,3,4,5-tetrabutylthiophene |
| SMILES | CCCCc1sc(CCCC)c(CCCC)c1CCCC |
| InChI | InChI=1S/C20H36S/c1-5-9-13-17-18(14-10-6-2)20(16-12-8-4)21-19(17)15-11-7-3/h5-16H2,1-4H3 |
| InChIKey | BAWOOFIRQHQRTC-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.57 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |