C11H19N3 — CID 143997682
(3E)-3-[(5-ethenyl-1,2,3,4-tetrahydropyridin-6-yl)imino]butan-1-amine (PubChem CID 143997682) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is (3E)-3-[(5-ethenyl-1,2,3,4-tetrahydropyridin-6-yl)imino]butan-1-amine.
| Compound Name | (3E)-3-[(5-ethenyl-1,2,3,4-tetrahydropyridin-6-yl)imino]butan-1-amine |
|---|---|
| PubChem CID | 143997682 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (3E)-3-[(5-ethenyl-1,2,3,4-tetrahydropyridin-6-yl)imino]butan-1-amine |
| SMILES | C=CC1=C(/N=C(\C)CCN)NCCC1 |
| InChI | InChI=1S/C11H19N3/c1-3-10-5-4-8-13-11(10)14-9(2)6-7-12/h3,13H,1,4-8,12H2,2H3/b14-9+ |
| InChIKey | DPMCIYNHLGYPNK-NTEUORMPSA-N |
| XLogP | 1.58 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|