C14H27N3O — CID 143997780
N-[(Z,3Z)-3-[2-(dimethylamino)propan-2-ylimino]hept-4-enyl]acetamide (PubChem CID 143997780) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is N-[(Z,3Z)-3-[2-(dimethylamino)propan-2-ylimino]hept-4-enyl]acetamide.
| Compound Name | N-[(Z,3Z)-3-[2-(dimethylamino)propan-2-ylimino]hept-4-enyl]acetamide |
|---|---|
| PubChem CID | 143997780 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | N-[(Z,3Z)-3-[2-(dimethylamino)propan-2-ylimino]hept-4-enyl]acetamide |
| SMILES | CC/C=C\C(CCNC(C)=O)=N/C(C)(C)N(C)C |
| InChI | InChI=1S/C14H27N3O/c1-7-8-9-13(10-11-15-12(2)18)16-14(3,4)17(5)6/h8-9H,7,10-11H2,1-6H3,(H,15,18)/b9-8-,16-13+ |
| InChIKey | FTRGBVIOOYHXIY-GVDTUOHXSA-N |
| XLogP | 2.22 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|