C28H24O8 — CID 14409181
8-[(1S,2S,3S,4S)-2,3-diacetyl-4-(7-methoxy-2-oxochromen-8-yl)cyclobutyl]-7-methoxychromen-2-one (PubChem CID 14409181) has the molecular formula C28H24O8 and a molecular weight of 488.49 g/mol. Its IUPAC name is 8-[(1S,2S,3S,4S)-2,3-diacetyl-4-(7-methoxy-2-oxochromen-8-yl)cyclobutyl]-7-methoxychromen-2-one.
| Compound Name | 8-[(1S,2S,3S,4S)-2,3-diacetyl-4-(7-methoxy-2-oxochromen-8-yl)cyclobutyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 14409181 |
| Molecular Formula | C28H24O8 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 8-[(1S,2S,3S,4S)-2,3-diacetyl-4-(7-methoxy-2-oxochromen-8-yl)cyclobutyl]-7-methoxychromen-2-one |
| SMILES | COc1ccc2ccc(=O)oc2c1[C@@H]1[C@H](C(C)=O)[C@@H](C(C)=O)[C@H]1c1c(OC)ccc2ccc(=O)oc12 |
| InChI | InChI=1S/C28H24O8/c1-13(29)21-22(14(2)30)26(24-18(34-4)10-6-16-8-12-20(32)36-28(16)24)25(21)23-17(33-3)9-5-15-7-11-19(31)35-27(15)23/h5-12,21-22,25-26H,1-4H3/t21-,22-,25+,26+/m1/s1 |
| InChIKey | WZTQDHIHDRTWFQ-PWGHIRGTSA-N |
| XLogP | 4.21 |
| TPSA | 113.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|