C26H22O9 — CID 11408956
[(1R,2R)-2-hydroxy-1-(7-methoxy-2-oxochromen-8-yl)-3-methylbut-3-enyl] 7-methoxy-2-oxochromene-8-carboxylate (PubChem CID 11408956) has the molecular formula C26H22O9 and a molecular weight of 478.45 g/mol. Its IUPAC name is [(1R,2R)-2-hydroxy-1-(7-methoxy-2-oxochromen-8-yl)-3-methylbut-3-enyl] 7-methoxy-2-oxochromene-8-carboxylate.
| Compound Name | [(1R,2R)-2-hydroxy-1-(7-methoxy-2-oxochromen-8-yl)-3-methylbut-3-enyl] 7-methoxy-2-oxochromene-8-carboxylate |
|---|---|
| PubChem CID | 11408956 |
| Molecular Formula | C26H22O9 |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | [(1R,2R)-2-hydroxy-1-(7-methoxy-2-oxochromen-8-yl)-3-methylbut-3-enyl] 7-methoxy-2-oxochromene-8-carboxylate |
| SMILES | C=C(C)[C@@H](O)[C@H](OC(=O)c1c(OC)ccc2ccc(=O)oc12)c1c(OC)ccc2ccc(=O)oc12 |
| InChI | InChI=1S/C26H22O9/c1-13(2)22(29)25(20-16(31-3)9-5-14-7-11-18(27)33-23(14)20)35-26(30)21-17(32-4)10-6-15-8-12-19(28)34-24(15)21/h5-12,22,25,29H,1H2,2-4H3/t22-,25-/m1/s1 |
| InChIKey | LJTQTAOKIUKBDS-RCZVLFRGSA-N |
| XLogP | 3.75 |
| TPSA | 125.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|