C18H18O7 — CID 15730551
[1-(6,7-dimethoxy-2-oxochromen-8-yl)-3-methyl-2-oxobut-3-enyl] acetate (PubChem CID 15730551) has the molecular formula C18H18O7 and a molecular weight of 346.34 g/mol. Its IUPAC name is [1-(6,7-dimethoxy-2-oxochromen-8-yl)-3-methyl-2-oxobut-3-enyl] acetate.
| Compound Name | [1-(6,7-dimethoxy-2-oxochromen-8-yl)-3-methyl-2-oxobut-3-enyl] acetate |
|---|---|
| PubChem CID | 15730551 |
| Molecular Formula | C18H18O7 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | [1-(6,7-dimethoxy-2-oxochromen-8-yl)-3-methyl-2-oxobut-3-enyl] acetate |
| SMILES | C=C(C)C(=O)C(OC(C)=O)c1c(OC)c(OC)cc2ccc(=O)oc12 |
| InChI | InChI=1S/C18H18O7/c1-9(2)15(21)18(24-10(3)19)14-16-11(6-7-13(20)25-16)8-12(22-4)17(14)23-5/h6-8,18H,1H2,2-5H3 |
| InChIKey | BKFJPWUZRRQLAM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|