C23H30O10 — CID 71492466
8-[1-ethoxy-3-methyl-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-3-enyl]-7-methoxychromen-2-one (PubChem CID 71492466) has the molecular formula C23H30O10 and a molecular weight of 466.48 g/mol. Its IUPAC name is 8-[1-ethoxy-3-methyl-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-3-enyl]-7-methoxychromen-2-one.
| Compound Name | 8-[1-ethoxy-3-methyl-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-3-enyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 71492466 |
| Molecular Formula | C23H30O10 |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 8-[1-ethoxy-3-methyl-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-3-enyl]-7-methoxychromen-2-one |
| SMILES | C=C(C)C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(OCC)c1c(OC)ccc2ccc(=O)oc12 |
| InChI | InChI=1S/C23H30O10/c1-5-30-22(16-13(29-4)8-6-12-7-9-15(25)32-21(12)16)20(11(2)3)33-23-19(28)18(27)17(26)14(10-24)31-23/h6-9,14,17-20,22-24,26-28H,2,5,10H2,1,3-4H3/t14-,17-,18+,19-,20?,22?,23+/m1/s1 |
| InChIKey | YDQCMYOXERJOMQ-YEIKJUIJSA-N |
| XLogP | 0.64 |
| TPSA | 148.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|