C25H32O12 — CID 132557425
[(1S)-3-hydroxy-3-methyl-2-oxo-1-[2-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-8-yl]butyl] 3-methylbutanoate (PubChem CID 132557425) has the molecular formula C25H32O12 and a molecular weight of 524.52 g/mol. Its IUPAC name is [(1S)-3-hydroxy-3-methyl-2-oxo-1-[2-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-8-yl]butyl] 3-methylbutanoate.
| Compound Name | [(1S)-3-hydroxy-3-methyl-2-oxo-1-[2-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-8-yl]butyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 132557425 |
| Molecular Formula | C25H32O12 |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | [(1S)-3-hydroxy-3-methyl-2-oxo-1-[2-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-8-yl]butyl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)O[C@H](C(=O)C(C)(C)O)c1c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)ccc2ccc(=O)oc12 |
| InChI | InChI=1S/C25H32O12/c1-11(2)9-16(28)37-22(23(32)25(3,4)33)17-13(7-5-12-6-8-15(27)36-21(12)17)34-24-20(31)19(30)18(29)14(10-26)35-24/h5-8,11,14,18-20,22,24,26,29-31,33H,9-10H2,1-4H3/t14-,18-,19+,20-,22+,24-/m1/s1 |
| InChIKey | ZENHFTZTNYOGCV-ZBLSBCCGSA-N |
| XLogP | -0.06 |
| TPSA | 193.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|