C17H25O11P — CID 14410141
[(1S,2S,3S,4S,5S,6S)-3,4,5,6-tetraacetyloxy-1-methyl-1-oxo-1lambda5-phosphinan-2-yl]methyl acetate (PubChem CID 14410141) has the molecular formula C17H25O11P and a molecular weight of 436.35 g/mol. Its IUPAC name is [(1S,2S,3S,4S,5S,6S)-3,4,5,6-tetraacetyloxy-1-methyl-1-oxo-1lambda5-phosphinan-2-yl]methyl acetate.
| Compound Name | [(1S,2S,3S,4S,5S,6S)-3,4,5,6-tetraacetyloxy-1-methyl-1-oxo-1lambda5-phosphinan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14410141 |
| Molecular Formula | C17H25O11P |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | [(1S,2S,3S,4S,5S,6S)-3,4,5,6-tetraacetyloxy-1-methyl-1-oxo-1lambda5-phosphinan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[P@@]1(C)=O |
| InChI | InChI=1S/C17H25O11P/c1-8(18)24-7-13-14(25-9(2)19)15(26-10(3)20)16(27-11(4)21)17(28-12(5)22)29(13,6)23/h13-17H,7H2,1-6H3/t13-,14+,15-,16-,17-,29-/m0/s1 |
| InChIKey | GVSRESVSUBKQCG-PIKOUWCOSA-N |
| XLogP | 0.61 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|