C14H18N2O6 — CID 14410821
methyl (E)-3-[1-[3-hydroxy-4-(hydroxymethyl)cyclopentyl]-2,4-dioxopyrimidin-5-yl]prop-2-enoate (PubChem CID 14410821) has the molecular formula C14H18N2O6 and a molecular weight of 310.31 g/mol. Its IUPAC name is methyl (E)-3-[1-[3-hydroxy-4-(hydroxymethyl)cyclopentyl]-2,4-dioxopyrimidin-5-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[1-[3-hydroxy-4-(hydroxymethyl)cyclopentyl]-2,4-dioxopyrimidin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 14410821 |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | methyl (E)-3-[1-[3-hydroxy-4-(hydroxymethyl)cyclopentyl]-2,4-dioxopyrimidin-5-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cn(C2CC(O)C(CO)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H18N2O6/c1-22-12(19)3-2-8-6-16(14(21)15-13(8)20)10-4-9(7-17)11(18)5-10/h2-3,6,9-11,17-18H,4-5,7H2,1H3,(H,15,20,21)/b3-2+ |
| InChIKey | UBQVCSXZWMPOMN-NSCUHMNNSA-N |
| XLogP | -0.97 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|