C15H13NO2S — CID 14424352
2-(4-methoxyphenyl)-5-(5-methylthiophen-2-yl)-1,3-oxazole (PubChem CID 14424352) has the molecular formula C15H13NO2S and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-5-(5-methylthiophen-2-yl)-1,3-oxazole.
| Compound Name | 2-(4-methoxyphenyl)-5-(5-methylthiophen-2-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 14424352 |
| Molecular Formula | C15H13NO2S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-(4-methoxyphenyl)-5-(5-methylthiophen-2-yl)-1,3-oxazole |
| SMILES | COc1ccc(-c2ncc(-c3ccc(C)s3)o2)cc1 |
| InChI | InChI=1S/C15H13NO2S/c1-10-3-8-14(19-10)13-9-16-15(18-13)11-4-6-12(17-2)7-5-11/h3-9H,1-2H3 |
| InChIKey | WDDLVVKZYKUNLR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |