C14H21NO6 — CID 14430971
[(1S,2R,4S,5R)-4-acetyloxy-3-(methoxymethoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-en-2-yl] acetate (PubChem CID 14430971) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is [(1S,2R,4S,5R)-4-acetyloxy-3-(methoxymethoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-en-2-yl] acetate.
| Compound Name | [(1S,2R,4S,5R)-4-acetyloxy-3-(methoxymethoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-en-2-yl] acetate |
|---|---|
| PubChem CID | 14430971 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [(1S,2R,4S,5R)-4-acetyloxy-3-(methoxymethoxy)-8-methyl-8-azabicyclo[3.2.1]oct-6-en-2-yl] acetate |
| SMILES | COCOC1[C@@H](OC(C)=O)[C@H]2C=C[C@@H]([C@H]1OC(C)=O)N2C |
| InChI | InChI=1S/C14H21NO6/c1-8(16)20-12-10-5-6-11(15(10)3)13(21-9(2)17)14(12)19-7-18-4/h5-6,10-14H,7H2,1-4H3/t10-,11+,12+,13-,14? |
| InChIKey | RYBXGAMABLTQNJ-PLADLKKGSA-N |
| XLogP | 0.09 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|