C14H21NO4 — CID 11219348
[(3aR,4R,10aS,10bS)-2,2-dimethyl-4,5,7,10,10a,10b-hexahydro-3aH-[1,3]dioxolo[4,5-a]quinolizin-4-yl] acetate (PubChem CID 11219348) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is [(3aR,4R,10aS,10bS)-2,2-dimethyl-4,5,7,10,10a,10b-hexahydro-3aH-[1,3]dioxolo[4,5-a]quinolizin-4-yl] acetate.
| Compound Name | [(3aR,4R,10aS,10bS)-2,2-dimethyl-4,5,7,10,10a,10b-hexahydro-3aH-[1,3]dioxolo[4,5-a]quinolizin-4-yl] acetate |
|---|---|
| PubChem CID | 11219348 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | [(3aR,4R,10aS,10bS)-2,2-dimethyl-4,5,7,10,10a,10b-hexahydro-3aH-[1,3]dioxolo[4,5-a]quinolizin-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CN2CC=CC[C@H]2[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C14H21NO4/c1-9(16)17-11-8-15-7-5-4-6-10(15)12-13(11)19-14(2,3)18-12/h4-5,10-13H,6-8H2,1-3H3/t10-,11+,12-,13+/m0/s1 |
| InChIKey | WKJWAMBOFKCDAR-QNWHQSFQSA-N |
| XLogP | 1.08 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|