C9H20OSi — CID 14433608
[(2R,3S)-3-tert-butyloxiran-2-yl]-trimethylsilane (PubChem CID 14433608) has the molecular formula C9H20OSi and a molecular weight of 172.34 g/mol. Its IUPAC name is [(2R,3S)-3-tert-butyloxiran-2-yl]-trimethylsilane.
| Compound Name | [(2R,3S)-3-tert-butyloxiran-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 14433608 |
| Molecular Formula | C9H20OSi |
| Molecular Weight | 172.34 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | [(2R,3S)-3-tert-butyloxiran-2-yl]-trimethylsilane |
| SMILES | CC(C)(C)[C@@H]1O[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C9H20OSi/c1-9(2,3)7-8(10-7)11(4,5)6/h7-8H,1-6H3/t7-,8-/m1/s1 |
| InChIKey | LOJGMFDGACBSEX-HTQZYQBOSA-N |
| XLogP | 2.68 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|