About tert-butyl(dimethyl)silane;2-ethyloxirane
tert-butyl(dimethyl)silane;2-ethyloxirane (PubChem CID 173207200) has the molecular formula C10H24OSi
and a molecular weight of 188.39 g/mol. Its IUPAC name is tert-butyl(dimethyl)silane;2-ethyloxirane.
Molecular Properties
| Compound Name | tert-butyl(dimethyl)silane;2-ethyloxirane |
| PubChem CID | 173207200 |
| Molecular Formula | C10H24OSi |
| Molecular Weight | 188.39 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | tert-butyl(dimethyl)silane;2-ethyloxirane |
| SMILES | CCC1CO1.C[SiH](C)C(C)(C)C |
| InChI | InChI=1S/C6H16Si.C4H8O/c1-6(2,3)7(4)5;1-2-4-3-5-4/h7H,1-5H3;4H,2-3H2,1H3 |
| InChIKey | YMHPATPEGRPNNL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl(dimethyl)silane;2-ethyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl(dimethyl)silane;2-ethyloxirane?
The IUPAC name of tert-butyl(dimethyl)silane;2-ethyloxirane (CID 173207200) is tert-butyl(dimethyl)silane;2-ethyloxirane.
What is the SMILES notation for tert-butyl(dimethyl)silane;2-ethyloxirane?
The canonical SMILES for tert-butyl(dimethyl)silane;2-ethyloxirane is CCC1CO1.C[SiH](C)C(C)(C)C.
What is the InChIKey of tert-butyl(dimethyl)silane;2-ethyloxirane?
The InChIKey is YMHPATPEGRPNNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16Si.C4H8O/c1-6(2,3)7(4)5;1-2-4-3-5-4/h7H,1-5H3;4H,2-3H2,1H3.
What are the key properties of tert-butyl(dimethyl)silane;2-ethyloxirane?
tert-butyl(dimethyl)silane;2-ethyloxirane has a molecular weight of 188.39 g/mol, XLogP of 3.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl(dimethyl)silane;2-ethyloxirane is sourced from PubChem (CID 173207200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).