C22H25N3O4 — CID 1443458
(2S)-1-N-(3-acetylphenyl)-2-N-(2-ethoxyphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 1443458) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is (2S)-1-N-(3-acetylphenyl)-2-N-(2-ethoxyphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-1-N-(3-acetylphenyl)-2-N-(2-ethoxyphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 1443458 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | (2S)-1-N-(3-acetylphenyl)-2-N-(2-ethoxyphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | CCOc1ccccc1NC(=O)[C@@H]1CCCN1C(=O)Nc1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C22H25N3O4/c1-3-29-20-12-5-4-10-18(20)24-21(27)19-11-7-13-25(19)22(28)23-17-9-6-8-16(14-17)15(2)26/h4-6,8-10,12,14,19H,3,7,11,13H2,1-2H3,(H,23,28)(H,24,27)/t19-/m0/s1 |
| InChIKey | VEWYZYXRQHNOOW-IBGZPJMESA-N |
| XLogP | 3.92 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |