C15H7Cl3N2O — CID 14435236
3-oxo-2-(3,4,5-trichlorophenyl)-1H-isoindole-1-carbonitrile (PubChem CID 14435236) has the molecular formula C15H7Cl3N2O and a molecular weight of 337.59 g/mol. Its IUPAC name is 3-oxo-2-(3,4,5-trichlorophenyl)-1H-isoindole-1-carbonitrile.
| Compound Name | 3-oxo-2-(3,4,5-trichlorophenyl)-1H-isoindole-1-carbonitrile |
|---|---|
| PubChem CID | 14435236 |
| Molecular Formula | C15H7Cl3N2O |
| Molecular Weight | 337.59 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 3-oxo-2-(3,4,5-trichlorophenyl)-1H-isoindole-1-carbonitrile |
| SMILES | N#CC1c2ccccc2C(=O)N1c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H7Cl3N2O/c16-11-5-8(6-12(17)14(11)18)20-13(7-19)9-3-1-2-4-10(9)15(20)21/h1-6,13H |
| InChIKey | QLAMZYZHSBDTPL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|